Name | isopentyl p-methoxycinnamate |
Synonyms | neoheltopane1000 Amyl P-Methoxy Cinnamate Isoamylp-methoxycinnamate Isoamyl 4-methoxycinnamate IsoaMyl 4-MethoxycinnaMate Isoamyl P-methoxycinnamate ISOPENTYL-4-METHOXYCINNAMATE isopentyl p-methoxycinnamate ISOPENTYLPARAMETHOXYCINNAMATE 3-Methylbutyl3-(4-methoxyphenyl)-2-propenoate 3-methylbutyl 3-(4-methoxyphenyl)prop-2-enoate 3-methylbutyl (2E)-3-(4-methoxyphenyl)prop-2-enoate (E)-2-methoxy-3-phenyl-2-propenoic acid 3-methylbutyl ester |
CAS | 71617-10-2 |
EINECS | 275-702-5 |
InChI | InChI=1/C15H20O3/c1-12(2)10-11-18-15(16)9-6-13-4-7-14(17-3)8-5-13/h4-9,12H,10-11H2,1-3H3/b9-6+ |
Molecular Formula | C15H20O3 |
Molar Mass | 248.32 |
Density | 1.04 |
Boling Point | 158°C/0.7mmHg(lit.) |
Flash Point | 151.6°C |
Vapor Presure | 1.89E-05mmHg at 25°C |
Appearance | Solid |
BRN | 3132627 |
Storage Condition | 2-8℃ |
Refractive Index | 1.5560 to 1.5600 |
MDL | MFCD00583856 |
WGK Germany | 2 |
RTECS | UD3393500 |
HS Code | 29181990 |
biological activity | Amiloxate (Amiloxiate, Isoamyl Methoxycinnamate, Isopentyl 4-methoxycinnamate, Isoamyl 4-methoxycinnamate, Isoamyl p-methoxycinnamate, Isopentyl p-methoxycinnamate) is an EMA approved chemical ultraviolet filter that can be used in cosmetics. Amiloxate is a cinnamic acid derivative with anti-inflammatory activity. |